Organic acids and derivatives
Filtered Search Results
Thermo Scientific Chemicals trans-1,2-Diaminocyclohexane-N,N,N',N'-tetraacetic Acid Monohydrate, 98%
CAS: 125572-95-4 Molecular Formula: C14H20N2O8 Molecular Weight (g/mol): 344.32 MDL Number: MFCD00149243,MFCD00066429,MFCD00003845 InChI Key: FCKYPQBAHLOOJQ-NXEZZACHSA-L Synonym: 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd PubChem CID: 2723844 SMILES: [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O
| PubChem CID | 2723844 |
|---|---|
| CAS | 125572-95-4 |
| Molecular Weight (g/mol) | 344.32 |
| MDL Number | MFCD00149243,MFCD00066429,MFCD00003845 |
| SMILES | [O-]C(=O)C[NH+](CC([O-])=O)[C@@H]1CCCC[C@H]1[NH+](CC([O-])=O)CC([O-])=O |
| Synonym | 2,2',2,2'-trans-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,dcyta,trans-1,2-diaminocyclohexane-n,n,n',n'-tetraacetic acid monohydrate,1,2-cyclohexanedinitrilotetraacetic acid,2,2',2,2'-1r,2r-rel-cyclohexane-1,2-diylbis azanetriyl tetraacetic acid hydrate,trans-1,2-cyclohexanediaminetetraacetic acid monohydrate,cdta monohydrate,ctda monohydrate,chel-cd,chel r-cd |
| InChI Key | FCKYPQBAHLOOJQ-NXEZZACHSA-L |
| Molecular Formula | C14H20N2O8 |
Thermo Scientific Chemicals Urea, 98%, extra pure, pearls
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 MDL Number: MFCD00008022 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| MDL Number | MFCD00008022 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals Dimethyl carbonate, 99+%, Extra Dry, AcroSeal™
CAS: 616-38-6 Molecular Formula: C3H6O3 Molecular Weight (g/mol): 90.08 MDL Number: MFCD00008420 InChI Key: IEJIGPNLZYLLBP-UHFFFAOYSA-N Synonym: methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 PubChem CID: 12021 ChEBI: CHEBI:36596 IUPAC Name: dimethyl carbonate SMILES: COC(=O)OC
| PubChem CID | 12021 |
|---|---|
| CAS | 616-38-6 |
| Molecular Weight (g/mol) | 90.08 |
| ChEBI | CHEBI:36596 |
| MDL Number | MFCD00008420 |
| SMILES | COC(=O)OC |
| Synonym | methyl carbonate,carbonic acid, dimethyl ester,carbonic acid dimethyl ester,methyl carbonate meo 2co,unii-ke9j097spn,dimethylcarbonate,ch3ocooch3,ke9j097spn,dimethyl ester of carbonic acid,dsstox_cid_9192 |
| IUPAC Name | dimethyl carbonate |
| InChI Key | IEJIGPNLZYLLBP-UHFFFAOYSA-N |
| Molecular Formula | C3H6O3 |
Thermo Scientific Chemicals Phenylboronic acid, 98+%, may contain varying amounts of anhydride
CAS: 98-80-6 Molecular Formula: C6H7BO2 Molecular Weight (g/mol): 121.93 MDL Number: MFCD00002103 InChI Key: HXITXNWTGFUOAU-UHFFFAOYSA-N Synonym: benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 PubChem CID: 66827 ChEBI: CHEBI:44923 IUPAC Name: phenylboronic acid SMILES: OB(O)C1=CC=CC=C1
| PubChem CID | 66827 |
|---|---|
| CAS | 98-80-6 |
| Molecular Weight (g/mol) | 121.93 |
| ChEBI | CHEBI:44923 |
| MDL Number | MFCD00002103 |
| SMILES | OB(O)C1=CC=CC=C1 |
| Synonym | benzeneboronic acid,boronic acid, phenyl,phenyl boronic acid,phenylboric acid,dihydroxyphenylborane,phenyldihydroxyborane,dihydroxy phenyl borane,phenylboronicacid,borophenylic acid,usaf bo-2 |
| IUPAC Name | phenylboronic acid |
| InChI Key | HXITXNWTGFUOAU-UHFFFAOYSA-N |
| Molecular Formula | C6H7BO2 |
Thermo Scientific Chemicals tert-Butyldimethylsilyl trifluoromethanesulfonate, 98%
CAS: 69739-34-0 Molecular Formula: C7H15F3O3SSi Molecular Weight (g/mol): 264.33 MDL Number: MFCD00000405 InChI Key: WLLIXJBWWFGEHT-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate PubChem CID: 123564 IUPAC Name: [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate SMILES: CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F
| PubChem CID | 123564 |
|---|---|
| CAS | 69739-34-0 |
| Molecular Weight (g/mol) | 264.33 |
| MDL Number | MFCD00000405 |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| Synonym | tert-butyldimethylsilyl trifluoromethanesulfonate,trifluoromethanesulfonic acid tert-butyldimethylsilyl ester,tbdms triflate,t-butyldimethylsilyl triflate,tert-butyldimethylsilyl trifluoromethanesulphonate,tbdms-otf,tert-butyldimethylsilyl triflate,silane tbm2 triflate,t-butyldimethylsilyltrifluoromethanesulfonate,t-butylmethylsilyl triflate |
| IUPAC Name | [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate |
| InChI Key | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| Molecular Formula | C7H15F3O3SSi |
Thermo Scientific Chemicals Triethyl citrate, 99%
CAS: 77-93-0 Molecular Formula: C12H20O7 Molecular Weight (g/mol): 276.285 MDL Number: MFCD00009201 InChI Key: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC Name: triethyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| CAS | 77-93-0 |
| Molecular Weight (g/mol) | 276.285 |
| MDL Number | MFCD00009201 |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molecular Formula | C12H20O7 |
Thermo Scientific MES Monohydrate, ≥98.5% (Dry Basis), Ultrapure
CAS: 145224-94-8 Molecular Formula: C6H15NO5S Molecular Weight (g/mol): 213.248 MDL Number: MFCD00149409 InChI Key: MIIIXQJBDGSIKL-UHFFFAOYSA-N Synonym: mes monohydrate,2-morpholinoethanesulfonic acid hydrate,mes hydrate,mes buffer hydrate,4-morpholineethanesulfonic acid monohydrate,4-morpholineethanesulfonic acid, monohydrate,2-4-morpholinyl ethanesulfonic acid hydrate,mes hydrate buffer,4-morpholineethanesulfonicacid, hydrate 1:1,mesmonohydrate PubChem CID: 16218417 IUPAC Name: 2-morpholin-4-ylethanesulfonic acid;hydrate SMILES: C1COCCN1CCS(=O)(=O)O.O
| PubChem CID | 16218417 |
|---|---|
| CAS | 145224-94-8 |
| Molecular Weight (g/mol) | 213.248 |
| MDL Number | MFCD00149409 |
| SMILES | C1COCCN1CCS(=O)(=O)O.O |
| Synonym | mes monohydrate,2-morpholinoethanesulfonic acid hydrate,mes hydrate,mes buffer hydrate,4-morpholineethanesulfonic acid monohydrate,4-morpholineethanesulfonic acid, monohydrate,2-4-morpholinyl ethanesulfonic acid hydrate,mes hydrate buffer,4-morpholineethanesulfonicacid, hydrate 1:1,mesmonohydrate |
| IUPAC Name | 2-morpholin-4-ylethanesulfonic acid;hydrate |
| InChI Key | MIIIXQJBDGSIKL-UHFFFAOYSA-N |
| Molecular Formula | C6H15NO5S |
Thermo Scientific Chemicals 1-Octanesulfonic acid, sodium salt, HPLC grade
CAS: 5324-84-5 Molecular Formula: C8H17NaO3S Molecular Weight (g/mol): 216.27 MDL Number: MFCD00007544 InChI Key: HRQDCDQDOPSGBR-UHFFFAOYSA-M Synonym: sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 PubChem CID: 23669624 SMILES: [Na+].CCCCCCCCS([O-])(=O)=O
| PubChem CID | 23669624 |
|---|---|
| CAS | 5324-84-5 |
| Molecular Weight (g/mol) | 216.27 |
| MDL Number | MFCD00007544 |
| SMILES | [Na+].CCCCCCCCS([O-])(=O)=O |
| Synonym | sodium 1-octanesulfonate,sodium octane-1-sulfonate,1-octanesulfonic acid sodium salt,sodium octanesulfonate,1-octanesulfonic acid, sodium salt,1-octanesulfonate, sodium,sodium octylsulfonate,unii-j46ez5jyb3,octyl sodium sulfonate,ipc-alks-8 |
| InChI Key | HRQDCDQDOPSGBR-UHFFFAOYSA-M |
| Molecular Formula | C8H17NaO3S |
Thioglycolic Acid 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 68-11-1 Molecular Formula: C2H4O2S Molecular Weight (g/mol): 92.112 MDL Number: MFCD00004876 InChI Key: CWERGRDVMFNCDR-UHFFFAOYSA-N Synonym: mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio PubChem CID: 1133 ChEBI: CHEBI:30065 IUPAC Name: 2-sulfanylacetic acid SMILES: C(C(=O)O)S
| PubChem CID | 1133 |
|---|---|
| CAS | 68-11-1 |
| Molecular Weight (g/mol) | 92.112 |
| ChEBI | CHEBI:30065 |
| MDL Number | MFCD00004876 |
| SMILES | C(C(=O)O)S |
| Synonym | mercaptoacetic acid,thioglycolic acid,2-thioglycolic acid,acetic acid, mercapto,2-mercaptoacetic acid,sulfanylacetic acid,thiovanic acid,mercaptoessigsaeure,thioglycollic acid,glycolic acid, thio |
| IUPAC Name | 2-sulfanylacetic acid |
| InChI Key | CWERGRDVMFNCDR-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2S |
Thermo Scientific Chemicals Ethyl cinnamate, 98% trans
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.21 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.21 |
| ChEBI | CHEBI:4895 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
Thermo Scientific Chemicals Urea, 99.5%, for analysis
CAS: 57-13-6 Molecular Formula: CH4N2O Molecular Weight (g/mol): 60.06 InChI Key: XSQUKJJJFZCRTK-UHFFFAOYSA-N Synonym: carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate PubChem CID: 1176 ChEBI: CHEBI:48376 IUPAC Name: urea SMILES: C(=O)(N)N
| PubChem CID | 1176 |
|---|---|
| CAS | 57-13-6 |
| Molecular Weight (g/mol) | 60.06 |
| ChEBI | CHEBI:48376 |
| SMILES | C(=O)(N)N |
| Synonym | carbamide,isourea,carbonyldiamide,ureophil,carbonyldiamine,carbamimidic acid,pseudourea,ureaphil,urevert,alphadrate |
| IUPAC Name | urea |
| InChI Key | XSQUKJJJFZCRTK-UHFFFAOYSA-N |
| Molecular Formula | CH4N2O |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, ACS, 99.4+%
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
Thermo Scientific Chemicals Nickel(II) acetate tetrahydrate, 98+%
CAS: 6018-89-9 Molecular Formula: C4H14NiO8 Molecular Weight (g/mol): 248.84 MDL Number: MFCD00066973 InChI Key: OINIXPNQKAZCRL-UHFFFAOYSA-L Synonym: nickel ii acetate tetrahydrate,nickel acetate tetrahydrate,nickel diacetate tetrahydrate,diacetatonickel tetrahydrate,nickelous acetate tetrahydrate,unii-6soa8l0560,acetic acid, nickel +2 salt, tetrahydrate,nickel 2+ diacetate tetrahydrate,nickel acetate tetrahydrate nickel and nickel compounds,acetic acid, nickel 2+ salt, tetrahydrate PubChem CID: 62601 IUPAC Name: nickel(2+);diacetate;tetrahydrate SMILES: O.O.O.O.[Ni++].CC([O-])=O.CC([O-])=O
| PubChem CID | 62601 |
|---|---|
| CAS | 6018-89-9 |
| Molecular Weight (g/mol) | 248.84 |
| MDL Number | MFCD00066973 |
| SMILES | O.O.O.O.[Ni++].CC([O-])=O.CC([O-])=O |
| Synonym | nickel ii acetate tetrahydrate,nickel acetate tetrahydrate,nickel diacetate tetrahydrate,diacetatonickel tetrahydrate,nickelous acetate tetrahydrate,unii-6soa8l0560,acetic acid, nickel +2 salt, tetrahydrate,nickel 2+ diacetate tetrahydrate,nickel acetate tetrahydrate nickel and nickel compounds,acetic acid, nickel 2+ salt, tetrahydrate |
| IUPAC Name | nickel(2+);diacetate;tetrahydrate |
| InChI Key | OINIXPNQKAZCRL-UHFFFAOYSA-L |
| Molecular Formula | C4H14NiO8 |
Thermo Scientific Chemicals Diethylenetriaminepentaacetic acid, pentasodium salt, tech., 40% aqueous solution
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| Linear Formula | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
|---|---|
| Molecular Weight (g/mol) | 503.26 |
| InChI Key | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Density | 1.2900g/mL |
| PubChem CID | 8779 |
| Name Note | 40% Aqueous Solution |
| Percent Purity | 39 to 41% |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| Formula Weight | 503.26 |
| Melting Point | -40°C |
| Boiling Point | 106°C |
| Physical Form | Solution |
| Chemical Name or Material | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Grade | Technical |
| SMILES | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| MDL Number | MFCD00051016 |
| Health Hazard 2 | GHS H Statement Causes serious eye irritation. |
| Solubility Information | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Packaging | Glass bottle |
| Flash Point | >100°C |
| Health Hazard 1 | GHS Signal Word: Warning |
| Refractive Index | 1.4185 to 1.4205 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
| Beilstein | 04, III, 1190 |
| Molecular Formula | C14H18N3Na5O10 |
| EINECS Number | 205-391-3 |
| Specific Gravity | 1.29 |
Thermo Scientific Chemicals Ethyl trifluoroacetate, 99%
CAS: 383-63-1 Molecular Formula: C4H5F3O2 Molecular Weight (g/mol): 142.08 MDL Number: MFCD00000419 InChI Key: STSCVKRWJPWALQ-UHFFFAOYSA-N Synonym: ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid PubChem CID: 9794 IUPAC Name: ethyl 2,2,2-trifluoroacetate SMILES: CCOC(=O)C(F)(F)F
| PubChem CID | 9794 |
|---|---|
| CAS | 383-63-1 |
| Molecular Weight (g/mol) | 142.08 |
| MDL Number | MFCD00000419 |
| SMILES | CCOC(=O)C(F)(F)F |
| Synonym | ethyl trifluoroacetate,trifluoroacetic acid ethyl ester,ethyltrifluoroacetate,acetic acid, trifluoro-, ethyl ester,trifluoroacetic acid, ethyl ester,ethyl trifluoroethanoate,unii-a6tzk6x11x,acetic acid, 2,2,2-trifluoro-, ethyl ester,a6tzk6x11x,ethyl ester of trifluoroacetic acid |
| IUPAC Name | ethyl 2,2,2-trifluoroacetate |
| InChI Key | STSCVKRWJPWALQ-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3O2 |